C5H9N5O2 — CID 143820747
4-diazenyl-1H-imidazole-5-carboxamide;methanol (PubChem CID 143820747) has the molecular formula C5H9N5O2 and a molecular weight of 171.16 g/mol. Its IUPAC name is 4-diazenyl-1H-imidazole-5-carboxamide;methanol.
| Compound Name | 4-diazenyl-1H-imidazole-5-carboxamide;methanol |
|---|---|
| PubChem CID | 143820747 |
| Molecular Formula | C5H9N5O2 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 4-diazenyl-1H-imidazole-5-carboxamide;methanol |
| SMILES | CO.[H]/N=N/c1nc[nH]c1C(N)=O |
| InChI | InChI=1S/C4H5N5O.CH4O/c5-3(10)2-4(9-6)8-1-7-2;1-2/h1,6H,(H2,5,10)(H,7,8);2H,1H3/b9-6+; |
| InChIKey | PCUGYWURCCVSIM-MLBSPLJJSA-N |
| XLogP | -0.22 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|