About 4-diazenyl-1H-imidazole-5-carboxamide;methanol
4-diazenyl-1H-imidazole-5-carboxamide;methanol (PubChem CID 143820747) has the molecular formula C5H9N5O2
and a molecular weight of 171.16 g/mol. Its IUPAC name is 4-diazenyl-1H-imidazole-5-carboxamide;methanol.
Molecular Properties
| Compound Name | 4-diazenyl-1H-imidazole-5-carboxamide;methanol |
| PubChem CID | 143820747 |
| Molecular Formula | C5H9N5O2 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 4-diazenyl-1H-imidazole-5-carboxamide;methanol |
| SMILES | CO.[H]/N=N/c1nc[nH]c1C(N)=O |
| InChI | InChI=1S/C4H5N5O.CH4O/c5-3(10)2-4(9-6)8-1-7-2;1-2/h1,6H,(H2,5,10)(H,7,8);2H,1H3/b9-6+; |
| InChIKey | PCUGYWURCCVSIM-MLBSPLJJSA-N |
| XLogP | -0.22 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-diazenyl-1H-imidazole-5-carboxamide;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diazenyl-1H-imidazole-5-carboxamide;methanol?
The IUPAC name of 4-diazenyl-1H-imidazole-5-carboxamide;methanol (CID 143820747) is 4-diazenyl-1H-imidazole-5-carboxamide;methanol.
What is the SMILES notation for 4-diazenyl-1H-imidazole-5-carboxamide;methanol?
The canonical SMILES for 4-diazenyl-1H-imidazole-5-carboxamide;methanol is CO.[H]/N=N/c1nc[nH]c1C(N)=O.
What is the InChIKey of 4-diazenyl-1H-imidazole-5-carboxamide;methanol?
The InChIKey is PCUGYWURCCVSIM-MLBSPLJJSA-N. The full InChI is InChI=1S/C4H5N5O.CH4O/c5-3(10)2-4(9-6)8-1-7-2;1-2/h1,6H,(H2,5,10)(H,7,8);2H,1H3/b9-6+;.
What are the key properties of 4-diazenyl-1H-imidazole-5-carboxamide;methanol?
4-diazenyl-1H-imidazole-5-carboxamide;methanol has a molecular weight of 171.16 g/mol, XLogP of -0.22, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diazenyl-1H-imidazole-5-carboxamide;methanol is sourced from PubChem (CID 143820747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).