C17H20F3NO4 — CID 143821049
4-(4-methoxybutyl)-2,2-dimethyl-3-oxo-7-(trifluoromethyl)-1,4-benzoxazine-6-carbaldehyde (PubChem CID 143821049) has the molecular formula C17H20F3NO4 and a molecular weight of 359.34 g/mol. Its IUPAC name is 4-(4-methoxybutyl)-2,2-dimethyl-3-oxo-7-(trifluoromethyl)-1,4-benzoxazine-6-carbaldehyde.
| Compound Name | 4-(4-methoxybutyl)-2,2-dimethyl-3-oxo-7-(trifluoromethyl)-1,4-benzoxazine-6-carbaldehyde |
|---|---|
| PubChem CID | 143821049 |
| Molecular Formula | C17H20F3NO4 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 4-(4-methoxybutyl)-2,2-dimethyl-3-oxo-7-(trifluoromethyl)-1,4-benzoxazine-6-carbaldehyde |
| SMILES | COCCCCN1C(=O)C(C)(C)Oc2cc(C(F)(F)F)c(C=O)cc21 |
| InChI | InChI=1S/C17H20F3NO4/c1-16(2)15(23)21(6-4-5-7-24-3)13-8-11(10-22)12(17(18,19)20)9-14(13)25-16/h8-10H,4-7H2,1-3H3 |
| InChIKey | JJQIIXCGWPJTQP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|