C20H29N3O3 — CID 143821060
4-(5-iminopentyl)-2,2,7-trimethyl-3-oxo-N-propan-2-yl-1,4-benzoxazine-6-carboxamide (PubChem CID 143821060) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-(5-iminopentyl)-2,2,7-trimethyl-3-oxo-N-propan-2-yl-1,4-benzoxazine-6-carboxamide.
| Compound Name | 4-(5-iminopentyl)-2,2,7-trimethyl-3-oxo-N-propan-2-yl-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 143821060 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 4-(5-iminopentyl)-2,2,7-trimethyl-3-oxo-N-propan-2-yl-1,4-benzoxazine-6-carboxamide |
| SMILES | [H]/N=C/CCCCN1C(=O)C(C)(C)Oc2cc(C)c(C(=O)NC(C)C)cc21 |
| InChI | InChI=1S/C20H29N3O3/c1-13(2)22-18(24)15-12-16-17(11-14(15)3)26-20(4,5)19(25)23(16)10-8-6-7-9-21/h9,11-13,21H,6-8,10H2,1-5H3,(H,22,24)/b21-9+ |
| InChIKey | ASKVVKAXDDSUQY-ZVBGSRNCSA-N |
| XLogP | 3.46 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|