About phenoxymethylbenzene;(3R)-piperidine-3-carboxylic acid
phenoxymethylbenzene;(3R)-piperidine-3-carboxylic acid (PubChem CID 143821300) has the molecular formula C19H23NO3
and a molecular weight of 313.40 g/mol. Its IUPAC name is phenoxymethylbenzene;(3R)-piperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | phenoxymethylbenzene;(3R)-piperidine-3-carboxylic acid |
| PubChem CID | 143821300 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | phenoxymethylbenzene;(3R)-piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCNC1.c1ccc(COc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12O.C6H11NO2/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13;8-6(9)5-2-1-3-7-4-5/h1-10H,11H2;5,7H,1-4H2,(H,8,9)/t;5-/m.1/s1 |
| InChIKey | WYWCXRUKOWUORD-QDXATWJZSA-N |
| XLogP | 3.34 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenoxymethylbenzene;(3R)-piperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenoxymethylbenzene;(3R)-piperidine-3-carboxylic acid?
The IUPAC name of phenoxymethylbenzene;(3R)-piperidine-3-carboxylic acid (CID 143821300) is phenoxymethylbenzene;(3R)-piperidine-3-carboxylic acid.
What is the SMILES notation for phenoxymethylbenzene;(3R)-piperidine-3-carboxylic acid?
The canonical SMILES for phenoxymethylbenzene;(3R)-piperidine-3-carboxylic acid is O=C(O)[C@@H]1CCCNC1.c1ccc(COc2ccccc2)cc1.
What is the InChIKey of phenoxymethylbenzene;(3R)-piperidine-3-carboxylic acid?
The InChIKey is WYWCXRUKOWUORD-QDXATWJZSA-N. The full InChI is InChI=1S/C13H12O.C6H11NO2/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13;8-6(9)5-2-1-3-7-4-5/h1-10H,11H2;5,7H,1-4H2,(H,8,9)/t;5-/m.1/s1.
What are the key properties of phenoxymethylbenzene;(3R)-piperidine-3-carboxylic acid?
phenoxymethylbenzene;(3R)-piperidine-3-carboxylic acid has a molecular weight of 313.40 g/mol, XLogP of 3.34, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenoxymethylbenzene;(3R)-piperidine-3-carboxylic acid is sourced from PubChem (CID 143821300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).