C3H7FN2 — CID 143821709
(E)-1-fluoro-N-methylethene-1,2-diamine (PubChem CID 143821709) has the molecular formula C3H7FN2 and a molecular weight of 90.10 g/mol. Its IUPAC name is (E)-1-fluoro-N-methylethene-1,2-diamine.
| Compound Name | (E)-1-fluoro-N-methylethene-1,2-diamine |
|---|---|
| PubChem CID | 143821709 |
| Molecular Formula | C3H7FN2 |
| Molecular Weight | 90.10 g/mol |
| Exact Mass | 90.06 |
| IUPAC Name | (E)-1-fluoro-N-methylethene-1,2-diamine |
| SMILES | CN/C(F)=C\N |
| InChI | InChI=1S/C3H7FN2/c1-6-3(4)2-5/h2,6H,5H2,1H3/b3-2- |
| InChIKey | XAJODBKCKPRUCM-IHWYPQMZSA-N |
| XLogP | -0.07 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 90.10 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|