C27H25N7O — CID 143821986
4-[2-[6-[(pyridin-3-ylmethylamino)methyl]-3,4-dihydro-2H-chromen-3-yl]-3H-benzimidazol-5-yl]pyrimidin-2-amine (PubChem CID 143821986) has the molecular formula C27H25N7O and a molecular weight of 463.55 g/mol. Its IUPAC name is 4-[2-[6-[(pyridin-3-ylmethylamino)methyl]-3,4-dihydro-2H-chromen-3-yl]-3H-benzimidazol-5-yl]pyrimidin-2-amine.
| Compound Name | 4-[2-[6-[(pyridin-3-ylmethylamino)methyl]-3,4-dihydro-2H-chromen-3-yl]-3H-benzimidazol-5-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 143821986 |
| Molecular Formula | C27H25N7O |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 4-[2-[6-[(pyridin-3-ylmethylamino)methyl]-3,4-dihydro-2H-chromen-3-yl]-3H-benzimidazol-5-yl]pyrimidin-2-amine |
| SMILES | Nc1nccc(-c2ccc3nc(C4COc5ccc(CNCc6cccnc6)cc5C4)[nH]c3c2)n1 |
| InChI | InChI=1S/C27H25N7O/c28-27-31-9-7-22(34-27)19-4-5-23-24(12-19)33-26(32-23)21-11-20-10-17(3-6-25(20)35-16-21)13-30-15-18-2-1-8-29-14-18/h1-10,12,14,21,30H,11,13,15-16H2,(H,32,33)(H2,28,31,34) |
| InChIKey | OCAOHLDJLBEXQW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|