About (Z)-2-N-ethylidene-4-N,3-dimethylhept-2-ene-2,4-diimine
(Z)-2-N-ethylidene-4-N,3-dimethylhept-2-ene-2,4-diimine (PubChem CID 143822419) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is (Z)-2-N-ethylidene-4-N,3-dimethylhept-2-ene-2,4-diimine.
Molecular Properties
| Compound Name | (Z)-2-N-ethylidene-4-N,3-dimethylhept-2-ene-2,4-diimine |
| PubChem CID | 143822419 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (Z)-2-N-ethylidene-4-N,3-dimethylhept-2-ene-2,4-diimine |
| SMILES | C/C=N/C(C)=C(C)\C(CCC)=N\C |
| InChI | InChI=1S/C11H20N2/c1-6-8-11(12-5)9(3)10(4)13-7-2/h7H,6,8H2,1-5H3/b10-9-,12-11+,13-7+ |
| InChIKey | GJJAGUOFGBSYNS-AAXZQQRJSA-N |
| XLogP | 3.24 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-N-ethylidene-4-N,3-dimethylhept-2-ene-2,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-N-ethylidene-4-N,3-dimethylhept-2-ene-2,4-diimine?
The IUPAC name of (Z)-2-N-ethylidene-4-N,3-dimethylhept-2-ene-2,4-diimine (CID 143822419) is (Z)-2-N-ethylidene-4-N,3-dimethylhept-2-ene-2,4-diimine.
What is the SMILES notation for (Z)-2-N-ethylidene-4-N,3-dimethylhept-2-ene-2,4-diimine?
The canonical SMILES for (Z)-2-N-ethylidene-4-N,3-dimethylhept-2-ene-2,4-diimine is C/C=N/C(C)=C(C)\C(CCC)=N\C.
What is the InChIKey of (Z)-2-N-ethylidene-4-N,3-dimethylhept-2-ene-2,4-diimine?
The InChIKey is GJJAGUOFGBSYNS-AAXZQQRJSA-N. The full InChI is InChI=1S/C11H20N2/c1-6-8-11(12-5)9(3)10(4)13-7-2/h7H,6,8H2,1-5H3/b10-9-,12-11+,13-7+.
What are the key properties of (Z)-2-N-ethylidene-4-N,3-dimethylhept-2-ene-2,4-diimine?
(Z)-2-N-ethylidene-4-N,3-dimethylhept-2-ene-2,4-diimine has a molecular weight of 180.29 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-N-ethylidene-4-N,3-dimethylhept-2-ene-2,4-diimine is sourced from PubChem (CID 143822419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).