C32H43NO2 — CID 143822741
N-[1-(4-tert-butylphenyl)ethyl]-N-[2-(4-methoxyphenyl)ethyl]propanamide;ethylbenzene (PubChem CID 143822741) has the molecular formula C32H43NO2 and a molecular weight of 473.70 g/mol. Its IUPAC name is N-[1-(4-tert-butylphenyl)ethyl]-N-[2-(4-methoxyphenyl)ethyl]propanamide;ethylbenzene.
| Compound Name | N-[1-(4-tert-butylphenyl)ethyl]-N-[2-(4-methoxyphenyl)ethyl]propanamide;ethylbenzene |
|---|---|
| PubChem CID | 143822741 |
| Molecular Formula | C32H43NO2 |
| Molecular Weight | 473.70 g/mol |
| Exact Mass | 473.33 |
| IUPAC Name | N-[1-(4-tert-butylphenyl)ethyl]-N-[2-(4-methoxyphenyl)ethyl]propanamide;ethylbenzene |
| SMILES | CCC(=O)N(CCc1ccc(OC)cc1)C(C)c1ccc(C(C)(C)C)cc1.CCc1ccccc1 |
| InChI | InChI=1S/C24H33NO2.C8H10/c1-7-23(26)25(17-16-19-8-14-22(27-6)15-9-19)18(2)20-10-12-21(13-11-20)24(3,4)5;1-2-8-6-4-3-5-7-8/h8-15,18H,7,16-17H2,1-6H3;3-7H,2H2,1H3 |
| InChIKey | GLVQPPLGVDIMDR-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.70 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |