About (4Z)-N-[1-(4-tert-butylphenyl)ethyl]-3-methylidene-N-(2-oxopropyl)hepta-4,6-dienamide
(4Z)-N-[1-(4-tert-butylphenyl)ethyl]-3-methylidene-N-(2-oxopropyl)hepta-4,6-dienamide (PubChem CID 143822895) has the molecular formula C23H31NO2
and a molecular weight of 353.51 g/mol. Its IUPAC name is (4Z)-N-[1-(4-tert-butylphenyl)ethyl]-3-methylidene-N-(2-oxopropyl)hepta-4,6-dienamide.
Molecular Properties
| Compound Name | (4Z)-N-[1-(4-tert-butylphenyl)ethyl]-3-methylidene-N-(2-oxopropyl)hepta-4,6-dienamide |
| PubChem CID | 143822895 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | (4Z)-N-[1-(4-tert-butylphenyl)ethyl]-3-methylidene-N-(2-oxopropyl)hepta-4,6-dienamide |
| SMILES | C=C/C=C\C(=C)CC(=O)N(CC(C)=O)C(C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H31NO2/c1-8-9-10-17(2)15-22(26)24(16-18(3)25)19(4)20-11-13-21(14-12-20)23(5,6)7/h8-14,19H,1-2,15-16H2,3-7H3/b10-9- |
| InChIKey | LYUQWBLGENMXTO-KTKRTIGZSA-N |
| XLogP | 5.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-N-[1-(4-tert-butylphenyl)ethyl]-3-methylidene-N-(2-oxopropyl)hepta-4,6-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-N-[1-(4-tert-butylphenyl)ethyl]-3-methylidene-N-(2-oxopropyl)hepta-4,6-dienamide?
The IUPAC name of (4Z)-N-[1-(4-tert-butylphenyl)ethyl]-3-methylidene-N-(2-oxopropyl)hepta-4,6-dienamide (CID 143822895) is (4Z)-N-[1-(4-tert-butylphenyl)ethyl]-3-methylidene-N-(2-oxopropyl)hepta-4,6-dienamide.
What is the SMILES notation for (4Z)-N-[1-(4-tert-butylphenyl)ethyl]-3-methylidene-N-(2-oxopropyl)hepta-4,6-dienamide?
The canonical SMILES for (4Z)-N-[1-(4-tert-butylphenyl)ethyl]-3-methylidene-N-(2-oxopropyl)hepta-4,6-dienamide is C=C/C=C\C(=C)CC(=O)N(CC(C)=O)C(C)c1ccc(C(C)(C)C)cc1.
What is the InChIKey of (4Z)-N-[1-(4-tert-butylphenyl)ethyl]-3-methylidene-N-(2-oxopropyl)hepta-4,6-dienamide?
The InChIKey is LYUQWBLGENMXTO-KTKRTIGZSA-N. The full InChI is InChI=1S/C23H31NO2/c1-8-9-10-17(2)15-22(26)24(16-18(3)25)19(4)20-11-13-21(14-12-20)23(5,6)7/h8-14,19H,1-2,15-16H2,3-7H3/b10-9-.
What are the key properties of (4Z)-N-[1-(4-tert-butylphenyl)ethyl]-3-methylidene-N-(2-oxopropyl)hepta-4,6-dienamide?
(4Z)-N-[1-(4-tert-butylphenyl)ethyl]-3-methylidene-N-(2-oxopropyl)hepta-4,6-dienamide has a molecular weight of 353.51 g/mol, XLogP of 5.15, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-N-[1-(4-tert-butylphenyl)ethyl]-3-methylidene-N-(2-oxopropyl)hepta-4,6-dienamide is sourced from PubChem (CID 143822895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).