C32H31Cl2FN4O5 — CID 143823448
2-[4-chloro-2-[(3S)-6-chloro-2'-(5-fluoro-2-methylphenyl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-4'-yl]phenoxy]-N-(2-formamidoethyl)-2-methylpropanamide (PubChem CID 143823448) has the molecular formula C32H31Cl2FN4O5 and a molecular weight of 641.53 g/mol. Its IUPAC name is 2-[4-chloro-2-[(3S)-6-chloro-2'-(5-fluoro-2-methylphenyl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-4'-yl]phenoxy]-N-(2-formamidoethyl)-2-methylpropanamide.
| Compound Name | 2-[4-chloro-2-[(3S)-6-chloro-2'-(5-fluoro-2-methylphenyl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-4'-yl]phenoxy]-N-(2-formamidoethyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 143823448 |
| Molecular Formula | C32H31Cl2FN4O5 |
| Molecular Weight | 641.53 g/mol |
| Exact Mass | 640.17 |
| IUPAC Name | 2-[4-chloro-2-[(3S)-6-chloro-2'-(5-fluoro-2-methylphenyl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-4'-yl]phenoxy]-N-(2-formamidoethyl)-2-methylpropanamide |
| SMILES | Cc1ccc(F)cc1C1NC(=O)CC(c2cc(Cl)ccc2OC(C)(C)C(=O)NCCNC=O)[C@@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C32H31Cl2FN4O5/c1-17-4-7-20(35)14-21(17)28-32(23-8-5-19(34)13-25(23)38-30(32)43)24(15-27(41)39-28)22-12-18(33)6-9-26(22)44-31(2,3)29(42)37-11-10-36-16-40/h4-9,12-14,16,24,28H,10-11,15H2,1-3H3,(H,36,40)(H,37,42)(H,38,43)(H,39,41)/t24?,28?,32-/m1/s1 |
| InChIKey | CQJDKSVWGWKGLZ-PWJCZFGMSA-N |
| XLogP | 4.70 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|