About (8Z)-2-imino-3-oxa-17-azatricyclo[15.3.0.05,7]icos-8-ene-4,16-dione
(8Z)-2-imino-3-oxa-17-azatricyclo[15.3.0.05,7]icos-8-ene-4,16-dione (PubChem CID 143823876) has the molecular formula C18H26N2O3
and a molecular weight of 318.42 g/mol. Its IUPAC name is (8Z)-2-imino-3-oxa-17-azatricyclo[15.3.0.05,7]icos-8-ene-4,16-dione.
Molecular Properties
| Compound Name | (8Z)-2-imino-3-oxa-17-azatricyclo[15.3.0.05,7]icos-8-ene-4,16-dione |
| PubChem CID | 143823876 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (8Z)-2-imino-3-oxa-17-azatricyclo[15.3.0.05,7]icos-8-ene-4,16-dione |
| SMILES | [H]/N=C1\OC(=O)C2CC2/C=C\CCCCCCC(=O)N2CCCC12 |
| InChI | InChI=1S/C18H26N2O3/c19-17-15-9-7-11-20(15)16(21)10-6-4-2-1-3-5-8-13-12-14(13)18(22)23-17/h5,8,13-15,19H,1-4,6-7,9-12H2/b8-5-,19-17- |
| InChIKey | QBEZNOQWITWNNG-ZVORNCKRSA-N |
| XLogP | 3.04 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (8Z)-2-imino-3-oxa-17-azatricyclo[15.3.0.05,7]icos-8-ene-4,16-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8Z)-2-imino-3-oxa-17-azatricyclo[15.3.0.05,7]icos-8-ene-4,16-dione?
The IUPAC name of (8Z)-2-imino-3-oxa-17-azatricyclo[15.3.0.05,7]icos-8-ene-4,16-dione (CID 143823876) is (8Z)-2-imino-3-oxa-17-azatricyclo[15.3.0.05,7]icos-8-ene-4,16-dione.
What is the SMILES notation for (8Z)-2-imino-3-oxa-17-azatricyclo[15.3.0.05,7]icos-8-ene-4,16-dione?
The canonical SMILES for (8Z)-2-imino-3-oxa-17-azatricyclo[15.3.0.05,7]icos-8-ene-4,16-dione is [H]/N=C1\OC(=O)C2CC2/C=C\CCCCCCC(=O)N2CCCC12.
What is the InChIKey of (8Z)-2-imino-3-oxa-17-azatricyclo[15.3.0.05,7]icos-8-ene-4,16-dione?
The InChIKey is QBEZNOQWITWNNG-ZVORNCKRSA-N. The full InChI is InChI=1S/C18H26N2O3/c19-17-15-9-7-11-20(15)16(21)10-6-4-2-1-3-5-8-13-12-14(13)18(22)23-17/h5,8,13-15,19H,1-4,6-7,9-12H2/b8-5-,19-17-.
What are the key properties of (8Z)-2-imino-3-oxa-17-azatricyclo[15.3.0.05,7]icos-8-ene-4,16-dione?
(8Z)-2-imino-3-oxa-17-azatricyclo[15.3.0.05,7]icos-8-ene-4,16-dione has a molecular weight of 318.42 g/mol, XLogP of 3.04, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8Z)-2-imino-3-oxa-17-azatricyclo[15.3.0.05,7]icos-8-ene-4,16-dione is sourced from PubChem (CID 143823876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).