About ethane;6-[1-(trifluoromethyl)cyclobutyl]-1,2-dihydropyridine
ethane;6-[1-(trifluoromethyl)cyclobutyl]-1,2-dihydropyridine (PubChem CID 143824332) has the molecular formula C12H18F3N
and a molecular weight of 233.28 g/mol. Its IUPAC name is ethane;6-[1-(trifluoromethyl)cyclobutyl]-1,2-dihydropyridine.
Molecular Properties
| Compound Name | ethane;6-[1-(trifluoromethyl)cyclobutyl]-1,2-dihydropyridine |
| PubChem CID | 143824332 |
| Molecular Formula | C12H18F3N |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | ethane;6-[1-(trifluoromethyl)cyclobutyl]-1,2-dihydropyridine |
| SMILES | CC.FC(F)(F)C1(C2=CC=CCN2)CCC1 |
| InChI | InChI=1S/C10H12F3N.C2H6/c11-10(12,13)9(5-3-6-9)8-4-1-2-7-14-8;1-2/h1-2,4,14H,3,5-7H2;1-2H3 |
| InChIKey | DXSLTEAMFUUENR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;6-[1-(trifluoromethyl)cyclobutyl]-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-[1-(trifluoromethyl)cyclobutyl]-1,2-dihydropyridine?
The IUPAC name of ethane;6-[1-(trifluoromethyl)cyclobutyl]-1,2-dihydropyridine (CID 143824332) is ethane;6-[1-(trifluoromethyl)cyclobutyl]-1,2-dihydropyridine.
What is the SMILES notation for ethane;6-[1-(trifluoromethyl)cyclobutyl]-1,2-dihydropyridine?
The canonical SMILES for ethane;6-[1-(trifluoromethyl)cyclobutyl]-1,2-dihydropyridine is CC.FC(F)(F)C1(C2=CC=CCN2)CCC1.
What is the InChIKey of ethane;6-[1-(trifluoromethyl)cyclobutyl]-1,2-dihydropyridine?
The InChIKey is DXSLTEAMFUUENR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F3N.C2H6/c11-10(12,13)9(5-3-6-9)8-4-1-2-7-14-8;1-2/h1-2,4,14H,3,5-7H2;1-2H3.
What are the key properties of ethane;6-[1-(trifluoromethyl)cyclobutyl]-1,2-dihydropyridine?
ethane;6-[1-(trifluoromethyl)cyclobutyl]-1,2-dihydropyridine has a molecular weight of 233.28 g/mol, XLogP of 3.79, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-[1-(trifluoromethyl)cyclobutyl]-1,2-dihydropyridine is sourced from PubChem (CID 143824332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).