C14H20N2 — CID 143824336
2-[1-[(3E)-penta-1,3-dien-3-yl]cyclopentyl]-1,4-dihydropyrimidine (PubChem CID 143824336) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-[1-[(3E)-penta-1,3-dien-3-yl]cyclopentyl]-1,4-dihydropyrimidine.
| Compound Name | 2-[1-[(3E)-penta-1,3-dien-3-yl]cyclopentyl]-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 143824336 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-[1-[(3E)-penta-1,3-dien-3-yl]cyclopentyl]-1,4-dihydropyrimidine |
| SMILES | C=C/C(=C\C)C1(C2=NCC=CN2)CCCC1 |
| InChI | InChI=1S/C14H20N2/c1-3-12(4-2)14(8-5-6-9-14)13-15-10-7-11-16-13/h3-4,7,10H,1,5-6,8-9,11H2,2H3,(H,15,16)/b12-4+ |
| InChIKey | NMHYIOHWUMXDNB-UUILKARUSA-N |
| XLogP | 3.19 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|