C30H44ClN3O7 — CID 143824451
[(1Z,6E)-7-chloro-1-[[2-[[(2Z,4Z,6E)-8-(6-hydroxy-5-methoxy-3,6-dihydro-2H-pyran-2-yl)-6-methylocta-2,4,6-trienoyl]amino]-3,3-dimethylbutanoyl]amino]octa-1,6-dien-4-yl] carbamate (PubChem CID 143824451) has the molecular formula C30H44ClN3O7 and a molecular weight of 594.15 g/mol. Its IUPAC name is [(1Z,6E)-7-chloro-1-[[2-[[(2Z,4Z,6E)-8-(6-hydroxy-5-methoxy-3,6-dihydro-2H-pyran-2-yl)-6-methylocta-2,4,6-trienoyl]amino]-3,3-dimethylbutanoyl]amino]octa-1,6-dien-4-yl] carbamate.
| Compound Name | [(1Z,6E)-7-chloro-1-[[2-[[(2Z,4Z,6E)-8-(6-hydroxy-5-methoxy-3,6-dihydro-2H-pyran-2-yl)-6-methylocta-2,4,6-trienoyl]amino]-3,3-dimethylbutanoyl]amino]octa-1,6-dien-4-yl] carbamate |
|---|---|
| PubChem CID | 143824451 |
| Molecular Formula | C30H44ClN3O7 |
| Molecular Weight | 594.15 g/mol |
| Exact Mass | 593.29 |
| IUPAC Name | [(1Z,6E)-7-chloro-1-[[2-[[(2Z,4Z,6E)-8-(6-hydroxy-5-methoxy-3,6-dihydro-2H-pyran-2-yl)-6-methylocta-2,4,6-trienoyl]amino]-3,3-dimethylbutanoyl]amino]octa-1,6-dien-4-yl] carbamate |
| SMILES | COC1=CCC(C/C=C(C)/C=C\C=C/C(=O)NC(C(=O)N/C=C\CC(C/C=C(\C)Cl)OC(N)=O)C(C)(C)C)OC1O |
| InChI | InChI=1S/C30H44ClN3O7/c1-20(13-15-23-17-18-24(39-6)28(37)40-23)10-7-8-12-25(35)34-26(30(3,4)5)27(36)33-19-9-11-22(41-29(32)38)16-14-21(2)31/h7-10,12-14,18-19,22-23,26,28,37H,11,15-17H2,1-6H3,(H2,32,38)(H,33,36)(H,34,35)/b10-7-,12-8-,19-9-,20-13+,21-14+ |
| InChIKey | AGVOZYJJAMBQKC-PYBURNAUSA-N |
| XLogP | 4.62 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.15 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|