About S-[4-chloro-2-[2-(3,4-dichlorophenyl)ethylsulfanylamino]phenyl]thiohydroxylamine
S-[4-chloro-2-[2-(3,4-dichlorophenyl)ethylsulfanylamino]phenyl]thiohydroxylamine (PubChem CID 143826058) has the molecular formula C14H13Cl3N2S2
and a molecular weight of 379.77 g/mol. Its IUPAC name is S-[4-chloro-2-[2-(3,4-dichlorophenyl)ethylsulfanylamino]phenyl]thiohydroxylamine.
Molecular Properties
| Compound Name | S-[4-chloro-2-[2-(3,4-dichlorophenyl)ethylsulfanylamino]phenyl]thiohydroxylamine |
| PubChem CID | 143826058 |
| Molecular Formula | C14H13Cl3N2S2 |
| Molecular Weight | 379.77 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | S-[4-chloro-2-[2-(3,4-dichlorophenyl)ethylsulfanylamino]phenyl]thiohydroxylamine |
| SMILES | NSc1ccc(Cl)cc1NSCCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H13Cl3N2S2/c15-10-2-4-14(21-18)13(8-10)19-20-6-5-9-1-3-11(16)12(17)7-9/h1-4,7-8,19H,5-6,18H2 |
| InChIKey | KEBBVIZEEROOBO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.77 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze S-[4-chloro-2-[2-(3,4-dichlorophenyl)ethylsulfanylamino]phenyl]thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[4-chloro-2-[2-(3,4-dichlorophenyl)ethylsulfanylamino]phenyl]thiohydroxylamine?
The IUPAC name of S-[4-chloro-2-[2-(3,4-dichlorophenyl)ethylsulfanylamino]phenyl]thiohydroxylamine (CID 143826058) is S-[4-chloro-2-[2-(3,4-dichlorophenyl)ethylsulfanylamino]phenyl]thiohydroxylamine.
What is the SMILES notation for S-[4-chloro-2-[2-(3,4-dichlorophenyl)ethylsulfanylamino]phenyl]thiohydroxylamine?
The canonical SMILES for S-[4-chloro-2-[2-(3,4-dichlorophenyl)ethylsulfanylamino]phenyl]thiohydroxylamine is NSc1ccc(Cl)cc1NSCCc1ccc(Cl)c(Cl)c1.
What is the InChIKey of S-[4-chloro-2-[2-(3,4-dichlorophenyl)ethylsulfanylamino]phenyl]thiohydroxylamine?
The InChIKey is KEBBVIZEEROOBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Cl3N2S2/c15-10-2-4-14(21-18)13(8-10)19-20-6-5-9-1-3-11(16)12(17)7-9/h1-4,7-8,19H,5-6,18H2.
What are the key properties of S-[4-chloro-2-[2-(3,4-dichlorophenyl)ethylsulfanylamino]phenyl]thiohydroxylamine?
S-[4-chloro-2-[2-(3,4-dichlorophenyl)ethylsulfanylamino]phenyl]thiohydroxylamine has a molecular weight of 379.77 g/mol, XLogP of 5.92, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[4-chloro-2-[2-(3,4-dichlorophenyl)ethylsulfanylamino]phenyl]thiohydroxylamine is sourced from PubChem (CID 143826058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).