About N-[(4-hydroxypyrrolidin-2-yl)methyl]-N-methylethanimidamide;methanimine
N-[(4-hydroxypyrrolidin-2-yl)methyl]-N-methylethanimidamide;methanimine (PubChem CID 143826190) has the molecular formula C9H20N4O
and a molecular weight of 200.29 g/mol. Its IUPAC name is N-[(4-hydroxypyrrolidin-2-yl)methyl]-N-methylethanimidamide;methanimine.
Molecular Properties
| Compound Name | N-[(4-hydroxypyrrolidin-2-yl)methyl]-N-methylethanimidamide;methanimine |
| PubChem CID | 143826190 |
| Molecular Formula | C9H20N4O |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | N-[(4-hydroxypyrrolidin-2-yl)methyl]-N-methylethanimidamide;methanimine |
| SMILES | [H]/N=C(\C)N(C)CC1CC(O)CN1.[H]N=C |
| InChI | InChI=1S/C8H17N3O.CH3N/c1-6(9)11(2)5-7-3-8(12)4-10-7;1-2/h7-10,12H,3-5H2,1-2H3;2H,1H2/b9-6+; |
| InChIKey | HKVBAWWCVNANEI-MLBSPLJJSA-N |
| XLogP | -0.10 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-hydroxypyrrolidin-2-yl)methyl]-N-methylethanimidamide;methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-hydroxypyrrolidin-2-yl)methyl]-N-methylethanimidamide;methanimine?
The IUPAC name of N-[(4-hydroxypyrrolidin-2-yl)methyl]-N-methylethanimidamide;methanimine (CID 143826190) is N-[(4-hydroxypyrrolidin-2-yl)methyl]-N-methylethanimidamide;methanimine.
What is the SMILES notation for N-[(4-hydroxypyrrolidin-2-yl)methyl]-N-methylethanimidamide;methanimine?
The canonical SMILES for N-[(4-hydroxypyrrolidin-2-yl)methyl]-N-methylethanimidamide;methanimine is [H]/N=C(\C)N(C)CC1CC(O)CN1.[H]N=C.
What is the InChIKey of N-[(4-hydroxypyrrolidin-2-yl)methyl]-N-methylethanimidamide;methanimine?
The InChIKey is HKVBAWWCVNANEI-MLBSPLJJSA-N. The full InChI is InChI=1S/C8H17N3O.CH3N/c1-6(9)11(2)5-7-3-8(12)4-10-7;1-2/h7-10,12H,3-5H2,1-2H3;2H,1H2/b9-6+;.
What are the key properties of N-[(4-hydroxypyrrolidin-2-yl)methyl]-N-methylethanimidamide;methanimine?
N-[(4-hydroxypyrrolidin-2-yl)methyl]-N-methylethanimidamide;methanimine has a molecular weight of 200.29 g/mol, XLogP of -0.10, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-hydroxypyrrolidin-2-yl)methyl]-N-methylethanimidamide;methanimine is sourced from PubChem (CID 143826190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).