About 4-N-(2-ethoxyethyl)pent-4-ene-1,4-diamine;propane
4-N-(2-ethoxyethyl)pent-4-ene-1,4-diamine;propane (PubChem CID 143826307) has the molecular formula C12H28N2O
and a molecular weight of 216.37 g/mol. Its IUPAC name is 4-N-(2-ethoxyethyl)pent-4-ene-1,4-diamine;propane.
Molecular Properties
| Compound Name | 4-N-(2-ethoxyethyl)pent-4-ene-1,4-diamine;propane |
| PubChem CID | 143826307 |
| Molecular Formula | C12H28N2O |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.22 |
| IUPAC Name | 4-N-(2-ethoxyethyl)pent-4-ene-1,4-diamine;propane |
| SMILES | C=C(CCCN)NCCOCC.CCC |
| InChI | InChI=1S/C9H20N2O.C3H8/c1-3-12-8-7-11-9(2)5-4-6-10;1-3-2/h11H,2-8,10H2,1H3;3H2,1-2H3 |
| InChIKey | SLBQEGKXJFPGPV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(2-ethoxyethyl)pent-4-ene-1,4-diamine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(2-ethoxyethyl)pent-4-ene-1,4-diamine;propane?
The IUPAC name of 4-N-(2-ethoxyethyl)pent-4-ene-1,4-diamine;propane (CID 143826307) is 4-N-(2-ethoxyethyl)pent-4-ene-1,4-diamine;propane.
What is the SMILES notation for 4-N-(2-ethoxyethyl)pent-4-ene-1,4-diamine;propane?
The canonical SMILES for 4-N-(2-ethoxyethyl)pent-4-ene-1,4-diamine;propane is C=C(CCCN)NCCOCC.CCC.
What is the InChIKey of 4-N-(2-ethoxyethyl)pent-4-ene-1,4-diamine;propane?
The InChIKey is SLBQEGKXJFPGPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O.C3H8/c1-3-12-8-7-11-9(2)5-4-6-10;1-3-2/h11H,2-8,10H2,1H3;3H2,1-2H3.
What are the key properties of 4-N-(2-ethoxyethyl)pent-4-ene-1,4-diamine;propane?
4-N-(2-ethoxyethyl)pent-4-ene-1,4-diamine;propane has a molecular weight of 216.37 g/mol, XLogP of 2.28, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(2-ethoxyethyl)pent-4-ene-1,4-diamine;propane is sourced from PubChem (CID 143826307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).