About ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-1H-quinolin-4-one
ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-1H-quinolin-4-one (PubChem CID 143826563) has the molecular formula C20H27NO
and a molecular weight of 297.44 g/mol. Its IUPAC name is ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-1H-quinolin-4-one.
Molecular Properties
| Compound Name | ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-1H-quinolin-4-one |
| PubChem CID | 143826563 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-1H-quinolin-4-one |
| SMILES | C=C/C=C(\C=C)c1cc(=O)c2ccc(C)cc2[nH]1.CC.CC |
| InChI | InChI=1S/C16H15NO.2C2H6/c1-4-6-12(5-2)14-10-16(18)13-8-7-11(3)9-15(13)17-14;2*1-2/h4-10H,1-2H2,3H3,(H,17,18);2*1-2H3/b12-6+;; |
| InChIKey | HOBIYCODEZTKDW-HTFHIHPASA-N |
| XLogP | 5.64 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-1H-quinolin-4-one?
The IUPAC name of ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-1H-quinolin-4-one (CID 143826563) is ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-1H-quinolin-4-one.
What is the SMILES notation for ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-1H-quinolin-4-one?
The canonical SMILES for ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-1H-quinolin-4-one is C=C/C=C(\C=C)c1cc(=O)c2ccc(C)cc2[nH]1.CC.CC.
What is the InChIKey of ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-1H-quinolin-4-one?
The InChIKey is HOBIYCODEZTKDW-HTFHIHPASA-N. The full InChI is InChI=1S/C16H15NO.2C2H6/c1-4-6-12(5-2)14-10-16(18)13-8-7-11(3)9-15(13)17-14;2*1-2/h4-10H,1-2H2,3H3,(H,17,18);2*1-2H3/b12-6+;;.
What are the key properties of ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-1H-quinolin-4-one?
ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-1H-quinolin-4-one has a molecular weight of 297.44 g/mol, XLogP of 5.64, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]-7-methyl-1H-quinolin-4-one is sourced from PubChem (CID 143826563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).