About 4-ethoxy-7-methoxy-2-[(3E)-penta-1,3-dien-3-yl]quinoline;propane
4-ethoxy-7-methoxy-2-[(3E)-penta-1,3-dien-3-yl]quinoline;propane (PubChem CID 143826650) has the molecular formula C20H27NO2
and a molecular weight of 313.44 g/mol. Its IUPAC name is 4-ethoxy-7-methoxy-2-[(3E)-penta-1,3-dien-3-yl]quinoline;propane.
Molecular Properties
| Compound Name | 4-ethoxy-7-methoxy-2-[(3E)-penta-1,3-dien-3-yl]quinoline;propane |
| PubChem CID | 143826650 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 4-ethoxy-7-methoxy-2-[(3E)-penta-1,3-dien-3-yl]quinoline;propane |
| SMILES | C=C/C(=C\C)c1cc(OCC)c2ccc(OC)cc2n1.CCC |
| InChI | InChI=1S/C17H19NO2.C3H8/c1-5-12(6-2)15-11-17(20-7-3)14-9-8-13(19-4)10-16(14)18-15;1-3-2/h5-6,8-11H,1,7H2,2-4H3;3H2,1-2H3/b12-6+; |
| InChIKey | XRHACOGMUNPSBC-WXIWBVQFSA-N |
| XLogP | 5.65 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-7-methoxy-2-[(3E)-penta-1,3-dien-3-yl]quinoline;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-7-methoxy-2-[(3E)-penta-1,3-dien-3-yl]quinoline;propane?
The IUPAC name of 4-ethoxy-7-methoxy-2-[(3E)-penta-1,3-dien-3-yl]quinoline;propane (CID 143826650) is 4-ethoxy-7-methoxy-2-[(3E)-penta-1,3-dien-3-yl]quinoline;propane.
What is the SMILES notation for 4-ethoxy-7-methoxy-2-[(3E)-penta-1,3-dien-3-yl]quinoline;propane?
The canonical SMILES for 4-ethoxy-7-methoxy-2-[(3E)-penta-1,3-dien-3-yl]quinoline;propane is C=C/C(=C\C)c1cc(OCC)c2ccc(OC)cc2n1.CCC.
What is the InChIKey of 4-ethoxy-7-methoxy-2-[(3E)-penta-1,3-dien-3-yl]quinoline;propane?
The InChIKey is XRHACOGMUNPSBC-WXIWBVQFSA-N. The full InChI is InChI=1S/C17H19NO2.C3H8/c1-5-12(6-2)15-11-17(20-7-3)14-9-8-13(19-4)10-16(14)18-15;1-3-2/h5-6,8-11H,1,7H2,2-4H3;3H2,1-2H3/b12-6+;.
What are the key properties of 4-ethoxy-7-methoxy-2-[(3E)-penta-1,3-dien-3-yl]quinoline;propane?
4-ethoxy-7-methoxy-2-[(3E)-penta-1,3-dien-3-yl]quinoline;propane has a molecular weight of 313.44 g/mol, XLogP of 5.65, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-7-methoxy-2-[(3E)-penta-1,3-dien-3-yl]quinoline;propane is sourced from PubChem (CID 143826650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).