C10H16FN3O2 — CID 143827353
N-[(E)-3-amino-2-fluoro-3-methyliminoprop-1-enyl]-N-(5-methyloxolan-2-yl)formamide (PubChem CID 143827353) has the molecular formula C10H16FN3O2 and a molecular weight of 229.26 g/mol. Its IUPAC name is N-[(E)-3-amino-2-fluoro-3-methyliminoprop-1-enyl]-N-(5-methyloxolan-2-yl)formamide.
| Compound Name | N-[(E)-3-amino-2-fluoro-3-methyliminoprop-1-enyl]-N-(5-methyloxolan-2-yl)formamide |
|---|---|
| PubChem CID | 143827353 |
| Molecular Formula | C10H16FN3O2 |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | N-[(E)-3-amino-2-fluoro-3-methyliminoprop-1-enyl]-N-(5-methyloxolan-2-yl)formamide |
| SMILES | C/N=C(N)/C(F)=C\N(C=O)C1CCC(C)O1 |
| InChI | InChI=1S/C10H16FN3O2/c1-7-3-4-9(16-7)14(6-15)5-8(11)10(12)13-2/h5-7,9H,3-4H2,1-2H3,(H2,12,13)/b8-5+ |
| InChIKey | LDIVWZKDYGITBG-VMPITWQZSA-N |
| XLogP | 0.77 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|