C22H27F2NO3 — CID 143827498
(2R)-1-(2-ethyl-4-fluorophenoxy)-3-[2-[(2R)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]ethylamino]propan-2-ol (PubChem CID 143827498) has the molecular formula C22H27F2NO3 and a molecular weight of 391.46 g/mol. Its IUPAC name is (2R)-1-(2-ethyl-4-fluorophenoxy)-3-[2-[(2R)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]ethylamino]propan-2-ol.
| Compound Name | (2R)-1-(2-ethyl-4-fluorophenoxy)-3-[2-[(2R)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 143827498 |
| Molecular Formula | C22H27F2NO3 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | (2R)-1-(2-ethyl-4-fluorophenoxy)-3-[2-[(2R)-6-fluoro-3,4-dihydro-2H-chromen-2-yl]ethylamino]propan-2-ol |
| SMILES | CCc1cc(F)ccc1OC[C@H](O)CNCC[C@H]1CCc2cc(F)ccc2O1 |
| InChI | InChI=1S/C22H27F2NO3/c1-2-15-11-17(23)4-7-21(15)27-14-19(26)13-25-10-9-20-6-3-16-12-18(24)5-8-22(16)28-20/h4-5,7-8,11-12,19-20,25-26H,2-3,6,9-10,13-14H2,1H3/t19-,20-/m1/s1 |
| InChIKey | QFHMLIMIZMLWJI-WOJBJXKFSA-N |
| XLogP | 3.64 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|