C27H39N — CID 143827553
7,13-bis(ethenyl)-17-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-imine;2-methylbuta-1,3-diene (PubChem CID 143827553) has the molecular formula C27H39N and a molecular weight of 377.62 g/mol. Its IUPAC name is 7,13-bis(ethenyl)-17-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-imine;2-methylbuta-1,3-diene.
| Compound Name | 7,13-bis(ethenyl)-17-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-imine;2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 143827553 |
| Molecular Formula | C27H39N |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 377.31 |
| IUPAC Name | 7,13-bis(ethenyl)-17-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-imine;2-methylbuta-1,3-diene |
| SMILES | C=CC(=C)C.[H]/N=C1/C=C2CC(C=C)C3C(CCC4(C=C)C(C)CCC34)C2CC1 |
| InChI | InChI=1S/C22H31N.C5H8/c1-4-15-12-16-13-17(23)7-8-18(16)19-10-11-22(5-2)14(3)6-9-20(22)21(15)19;1-4-5(2)3/h4-5,13-15,18-21,23H,1-2,6-12H2,3H3;4H,1-2H2,3H3/b23-17+; |
| InChIKey | GABLOHRRPNNCMD-YFZNFVDXSA-N |
| XLogP | 7.54 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|