C26H41N — CID 143827558
buta-1,3-diene;ethane;13-ethenyl-17-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-imine (PubChem CID 143827558) has the molecular formula C26H41N and a molecular weight of 367.62 g/mol. Its IUPAC name is buta-1,3-diene;ethane;13-ethenyl-17-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-imine.
| Compound Name | buta-1,3-diene;ethane;13-ethenyl-17-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-imine |
|---|---|
| PubChem CID | 143827558 |
| Molecular Formula | C26H41N |
| Molecular Weight | 367.62 g/mol |
| Exact Mass | 367.32 |
| IUPAC Name | buta-1,3-diene;ethane;13-ethenyl-17-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-imine |
| SMILES | C=CC=C.CC.[H]/N=C1/C=C2CCC3C(CCC4(C=C)C(C)CCC34)C2CC1 |
| InChI | InChI=1S/C20H29N.C4H6.C2H6/c1-3-20-11-10-17-16-8-6-15(21)12-14(16)5-7-18(17)19(20)9-4-13(20)2;1-3-4-2;1-2/h3,12-13,16-19,21H,1,4-11H2,2H3;3-4H,1-2H2;1-2H3/b21-15+;; |
| InChIKey | ISBXWWCNVMJEHW-SMHPQPFFSA-N |
| XLogP | 7.77 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.62 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|