About 3,7-dimethyl-2H-indazole;propane
3,7-dimethyl-2H-indazole;propane (PubChem CID 143828593) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 3,7-dimethyl-2H-indazole;propane.
Molecular Properties
| Compound Name | 3,7-dimethyl-2H-indazole;propane |
| PubChem CID | 143828593 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 3,7-dimethyl-2H-indazole;propane |
| SMILES | CCC.Cc1[nH]nc2c(C)cccc12 |
| InChI | InChI=1S/C9H10N2.C3H8/c1-6-4-3-5-8-7(2)10-11-9(6)8;1-3-2/h3-5H,1-2H3,(H,10,11);3H2,1-2H3 |
| InChIKey | LMYGYXIZUDYOPM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,7-dimethyl-2H-indazole;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-2H-indazole;propane?
The IUPAC name of 3,7-dimethyl-2H-indazole;propane (CID 143828593) is 3,7-dimethyl-2H-indazole;propane.
What is the SMILES notation for 3,7-dimethyl-2H-indazole;propane?
The canonical SMILES for 3,7-dimethyl-2H-indazole;propane is CCC.Cc1[nH]nc2c(C)cccc12.
What is the InChIKey of 3,7-dimethyl-2H-indazole;propane?
The InChIKey is LMYGYXIZUDYOPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.C3H8/c1-6-4-3-5-8-7(2)10-11-9(6)8;1-3-2/h3-5H,1-2H3,(H,10,11);3H2,1-2H3.
What are the key properties of 3,7-dimethyl-2H-indazole;propane?
3,7-dimethyl-2H-indazole;propane has a molecular weight of 190.29 g/mol, XLogP of 3.60, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-2H-indazole;propane is sourced from PubChem (CID 143828593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).