About 6-iodo-4-methyl-1,2-benzothiazole
6-iodo-4-methyl-1,2-benzothiazole (PubChem CID 143828653) has the molecular formula C8H6INS
and a molecular weight of 275.11 g/mol. Its IUPAC name is 6-iodo-4-methyl-1,2-benzothiazole.
Molecular Properties
| Compound Name | 6-iodo-4-methyl-1,2-benzothiazole |
| PubChem CID | 143828653 |
| Molecular Formula | C8H6INS |
| Molecular Weight | 275.11 g/mol |
| Exact Mass | 274.93 |
| IUPAC Name | 6-iodo-4-methyl-1,2-benzothiazole |
| SMILES | Cc1cc(I)cc2sncc12 |
| InChI | InChI=1S/C8H6INS/c1-5-2-6(9)3-8-7(5)4-10-11-8/h2-4H,1H3 |
| InChIKey | QQJNKIMVDNMBNJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.11 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-4-methyl-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-4-methyl-1,2-benzothiazole?
The IUPAC name of 6-iodo-4-methyl-1,2-benzothiazole (CID 143828653) is 6-iodo-4-methyl-1,2-benzothiazole.
What is the SMILES notation for 6-iodo-4-methyl-1,2-benzothiazole?
The canonical SMILES for 6-iodo-4-methyl-1,2-benzothiazole is Cc1cc(I)cc2sncc12.
What is the InChIKey of 6-iodo-4-methyl-1,2-benzothiazole?
The InChIKey is QQJNKIMVDNMBNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6INS/c1-5-2-6(9)3-8-7(5)4-10-11-8/h2-4H,1H3.
What are the key properties of 6-iodo-4-methyl-1,2-benzothiazole?
6-iodo-4-methyl-1,2-benzothiazole has a molecular weight of 275.11 g/mol, XLogP of 3.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-4-methyl-1,2-benzothiazole is sourced from PubChem (CID 143828653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).