About [4-(1,2-dihydroimidazol-3-yl)cyclohexyl]methanamine;ethane
[4-(1,2-dihydroimidazol-3-yl)cyclohexyl]methanamine;ethane (PubChem CID 143829306) has the molecular formula C12H25N3
and a molecular weight of 211.35 g/mol. Its IUPAC name is [4-(1,2-dihydroimidazol-3-yl)cyclohexyl]methanamine;ethane.
Molecular Properties
| Compound Name | [4-(1,2-dihydroimidazol-3-yl)cyclohexyl]methanamine;ethane |
| PubChem CID | 143829306 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | [4-(1,2-dihydroimidazol-3-yl)cyclohexyl]methanamine;ethane |
| SMILES | CC.NCC1CCC(N2C=CNC2)CC1 |
| InChI | InChI=1S/C10H19N3.C2H6/c11-7-9-1-3-10(4-2-9)13-6-5-12-8-13;1-2/h5-6,9-10,12H,1-4,7-8,11H2;1-2H3 |
| InChIKey | JZQSMBMFOVOIHI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(1,2-dihydroimidazol-3-yl)cyclohexyl]methanamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,2-dihydroimidazol-3-yl)cyclohexyl]methanamine;ethane?
The IUPAC name of [4-(1,2-dihydroimidazol-3-yl)cyclohexyl]methanamine;ethane (CID 143829306) is [4-(1,2-dihydroimidazol-3-yl)cyclohexyl]methanamine;ethane.
What is the SMILES notation for [4-(1,2-dihydroimidazol-3-yl)cyclohexyl]methanamine;ethane?
The canonical SMILES for [4-(1,2-dihydroimidazol-3-yl)cyclohexyl]methanamine;ethane is CC.NCC1CCC(N2C=CNC2)CC1.
What is the InChIKey of [4-(1,2-dihydroimidazol-3-yl)cyclohexyl]methanamine;ethane?
The InChIKey is JZQSMBMFOVOIHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3.C2H6/c11-7-9-1-3-10(4-2-9)13-6-5-12-8-13;1-2/h5-6,9-10,12H,1-4,7-8,11H2;1-2H3.
What are the key properties of [4-(1,2-dihydroimidazol-3-yl)cyclohexyl]methanamine;ethane?
[4-(1,2-dihydroimidazol-3-yl)cyclohexyl]methanamine;ethane has a molecular weight of 211.35 g/mol, XLogP of 1.86, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,2-dihydroimidazol-3-yl)cyclohexyl]methanamine;ethane is sourced from PubChem (CID 143829306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).