About ethane;2-(6-methyl-1,2-dihydropyrazin-3-yl)ethanamine
ethane;2-(6-methyl-1,2-dihydropyrazin-3-yl)ethanamine (PubChem CID 143829320) has the molecular formula C9H19N3
and a molecular weight of 169.27 g/mol. Its IUPAC name is ethane;2-(6-methyl-1,2-dihydropyrazin-3-yl)ethanamine.
Molecular Properties
| Compound Name | ethane;2-(6-methyl-1,2-dihydropyrazin-3-yl)ethanamine |
| PubChem CID | 143829320 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | ethane;2-(6-methyl-1,2-dihydropyrazin-3-yl)ethanamine |
| SMILES | CC.CC1=CN=C(CCN)CN1 |
| InChI | InChI=1S/C7H13N3.C2H6/c1-6-4-10-7(2-3-8)5-9-6;1-2/h4,9H,2-3,5,8H2,1H3;1-2H3 |
| InChIKey | NOTJAWTTWGLQEG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-(6-methyl-1,2-dihydropyrazin-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(6-methyl-1,2-dihydropyrazin-3-yl)ethanamine?
The IUPAC name of ethane;2-(6-methyl-1,2-dihydropyrazin-3-yl)ethanamine (CID 143829320) is ethane;2-(6-methyl-1,2-dihydropyrazin-3-yl)ethanamine.
What is the SMILES notation for ethane;2-(6-methyl-1,2-dihydropyrazin-3-yl)ethanamine?
The canonical SMILES for ethane;2-(6-methyl-1,2-dihydropyrazin-3-yl)ethanamine is CC.CC1=CN=C(CCN)CN1.
What is the InChIKey of ethane;2-(6-methyl-1,2-dihydropyrazin-3-yl)ethanamine?
The InChIKey is NOTJAWTTWGLQEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3.C2H6/c1-6-4-10-7(2-3-8)5-9-6;1-2/h4,9H,2-3,5,8H2,1H3;1-2H3.
What are the key properties of ethane;2-(6-methyl-1,2-dihydropyrazin-3-yl)ethanamine?
ethane;2-(6-methyl-1,2-dihydropyrazin-3-yl)ethanamine has a molecular weight of 169.27 g/mol, XLogP of 1.27, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(6-methyl-1,2-dihydropyrazin-3-yl)ethanamine is sourced from PubChem (CID 143829320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).