C15H23N3O — CID 143829328
1-N-(6-methoxy-1,8a-dihydroquinolin-8-yl)pentane-1,4-diamine (PubChem CID 143829328) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-N-(6-methoxy-1,8a-dihydroquinolin-8-yl)pentane-1,4-diamine.
| Compound Name | 1-N-(6-methoxy-1,8a-dihydroquinolin-8-yl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 143829328 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 1-N-(6-methoxy-1,8a-dihydroquinolin-8-yl)pentane-1,4-diamine |
| SMILES | COC1=CC2=CC=CNC2C(NCCCC(C)N)=C1 |
| InChI | InChI=1S/C15H23N3O/c1-11(16)5-3-7-17-14-10-13(19-2)9-12-6-4-8-18-15(12)14/h4,6,8-11,15,17-18H,3,5,7,16H2,1-2H3 |
| InChIKey | UNIBDLFFMNYNPD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|