C24H23ClN2O4S — CID 143829497
2-[3-chloro-4-[4-(ethylcarbamoyl)-2-[(4-methylphenyl)sulfanylamino]phenoxy]phenyl]acetic acid (PubChem CID 143829497) has the molecular formula C24H23ClN2O4S and a molecular weight of 470.98 g/mol. Its IUPAC name is 2-[3-chloro-4-[4-(ethylcarbamoyl)-2-[(4-methylphenyl)sulfanylamino]phenoxy]phenyl]acetic acid.
| Compound Name | 2-[3-chloro-4-[4-(ethylcarbamoyl)-2-[(4-methylphenyl)sulfanylamino]phenoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 143829497 |
| Molecular Formula | C24H23ClN2O4S |
| Molecular Weight | 470.98 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 2-[3-chloro-4-[4-(ethylcarbamoyl)-2-[(4-methylphenyl)sulfanylamino]phenoxy]phenyl]acetic acid |
| SMILES | CCNC(=O)c1ccc(Oc2ccc(CC(=O)O)cc2Cl)c(NSc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C24H23ClN2O4S/c1-3-26-24(30)17-7-11-22(20(14-17)27-32-18-8-4-15(2)5-9-18)31-21-10-6-16(12-19(21)25)13-23(28)29/h4-12,14,27H,3,13H2,1-2H3,(H,26,30)(H,28,29) |
| InChIKey | UCEGOTGNKGPJPG-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.98 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|