C26H36N8O3S — CID 143830608
cyclopropanecarbaldehyde;methanamine;N-[2-[4-(methylamino)phenyl]sulfanyl-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-4-yl]-6-oxohexanamide (PubChem CID 143830608) has the molecular formula C26H36N8O3S and a molecular weight of 540.69 g/mol. Its IUPAC name is cyclopropanecarbaldehyde;methanamine;N-[2-[4-(methylamino)phenyl]sulfanyl-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-4-yl]-6-oxohexanamide.
| Compound Name | cyclopropanecarbaldehyde;methanamine;N-[2-[4-(methylamino)phenyl]sulfanyl-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-4-yl]-6-oxohexanamide |
|---|---|
| PubChem CID | 143830608 |
| Molecular Formula | C26H36N8O3S |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | cyclopropanecarbaldehyde;methanamine;N-[2-[4-(methylamino)phenyl]sulfanyl-6-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-4-yl]-6-oxohexanamide |
| SMILES | CN.CNc1ccc(Sc2nc(NC(=O)CCCCC=O)cc(Nc3cc(C)[nH]n3)n2)cc1.O=CC1CC1 |
| InChI | InChI=1S/C21H25N7O2S.C4H6O.CH5N/c1-14-12-19(28-27-14)23-17-13-18(24-20(30)6-4-3-5-11-29)26-21(25-17)31-16-9-7-15(22-2)8-10-16;5-3-4-1-2-4;1-2/h7-13,22H,3-6H2,1-2H3,(H3,23,24,25,26,27,28,30);3-4H,1-2H2;2H2,1H3 |
| InChIKey | BTEKLFNBHXEJIH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 167.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|