About 8-bromo-2-propan-2-yl-3H-[1]benzofuro[3,2-d]pyrimidin-4-one;ethane
8-bromo-2-propan-2-yl-3H-[1]benzofuro[3,2-d]pyrimidin-4-one;ethane (PubChem CID 143831013) has the molecular formula C15H17BrN2O2
and a molecular weight of 337.22 g/mol. Its IUPAC name is 8-bromo-2-propan-2-yl-3H-[1]benzofuro[3,2-d]pyrimidin-4-one;ethane.
Molecular Properties
| Compound Name | 8-bromo-2-propan-2-yl-3H-[1]benzofuro[3,2-d]pyrimidin-4-one;ethane |
| PubChem CID | 143831013 |
| Molecular Formula | C15H17BrN2O2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 8-bromo-2-propan-2-yl-3H-[1]benzofuro[3,2-d]pyrimidin-4-one;ethane |
| SMILES | CC.CC(C)c1nc2c(oc3ccc(Br)cc32)c(=O)[nH]1 |
| InChI | InChI=1S/C13H11BrN2O2.C2H6/c1-6(2)12-15-10-8-5-7(14)3-4-9(8)18-11(10)13(17)16-12;1-2/h3-6H,1-2H3,(H,15,16,17);1-2H3 |
| InChIKey | UFVFFSKEAXPTIS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-bromo-2-propan-2-yl-3H-[1]benzofuro[3,2-d]pyrimidin-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-2-propan-2-yl-3H-[1]benzofuro[3,2-d]pyrimidin-4-one;ethane?
The IUPAC name of 8-bromo-2-propan-2-yl-3H-[1]benzofuro[3,2-d]pyrimidin-4-one;ethane (CID 143831013) is 8-bromo-2-propan-2-yl-3H-[1]benzofuro[3,2-d]pyrimidin-4-one;ethane.
What is the SMILES notation for 8-bromo-2-propan-2-yl-3H-[1]benzofuro[3,2-d]pyrimidin-4-one;ethane?
The canonical SMILES for 8-bromo-2-propan-2-yl-3H-[1]benzofuro[3,2-d]pyrimidin-4-one;ethane is CC.CC(C)c1nc2c(oc3ccc(Br)cc32)c(=O)[nH]1.
What is the InChIKey of 8-bromo-2-propan-2-yl-3H-[1]benzofuro[3,2-d]pyrimidin-4-one;ethane?
The InChIKey is UFVFFSKEAXPTIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrN2O2.C2H6/c1-6(2)12-15-10-8-5-7(14)3-4-9(8)18-11(10)13(17)16-12;1-2/h3-6H,1-2H3,(H,15,16,17);1-2H3.
What are the key properties of 8-bromo-2-propan-2-yl-3H-[1]benzofuro[3,2-d]pyrimidin-4-one;ethane?
8-bromo-2-propan-2-yl-3H-[1]benzofuro[3,2-d]pyrimidin-4-one;ethane has a molecular weight of 337.22 g/mol, XLogP of 4.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-2-propan-2-yl-3H-[1]benzofuro[3,2-d]pyrimidin-4-one;ethane is sourced from PubChem (CID 143831013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).