C19H11BrClN5O3S — CID 143831024
N-[4-(8-bromo-4-oxo-3H-[1]benzofuro[3,2-d]pyrimidin-2-yl)-3-chlorophenyl]-2,3-dihydrothiadiazole-4-carboxamide (PubChem CID 143831024) has the molecular formula C19H11BrClN5O3S and a molecular weight of 504.75 g/mol. Its IUPAC name is N-[4-(8-bromo-4-oxo-3H-[1]benzofuro[3,2-d]pyrimidin-2-yl)-3-chlorophenyl]-2,3-dihydrothiadiazole-4-carboxamide.
| Compound Name | N-[4-(8-bromo-4-oxo-3H-[1]benzofuro[3,2-d]pyrimidin-2-yl)-3-chlorophenyl]-2,3-dihydrothiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 143831024 |
| Molecular Formula | C19H11BrClN5O3S |
| Molecular Weight | 504.75 g/mol |
| Exact Mass | 502.95 |
| IUPAC Name | N-[4-(8-bromo-4-oxo-3H-[1]benzofuro[3,2-d]pyrimidin-2-yl)-3-chlorophenyl]-2,3-dihydrothiadiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(-c2nc3c(oc4ccc(Br)cc43)c(=O)[nH]2)c(Cl)c1)C1=CSNN1 |
| InChI | InChI=1S/C19H11BrClN5O3S/c20-8-1-4-14-11(5-8)15-16(29-14)19(28)24-17(23-15)10-3-2-9(6-12(10)21)22-18(27)13-7-30-26-25-13/h1-7,25-26H,(H,22,27)(H,23,24,28) |
| InChIKey | JBQBIRVAUFMOTR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.75 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|