About ethane;5-methyl-6-[(Z)-prop-1-enyl]cyclohexa-1,3-diene
ethane;5-methyl-6-[(Z)-prop-1-enyl]cyclohexa-1,3-diene (PubChem CID 143831212) has the molecular formula C12H20
and a molecular weight of 164.29 g/mol. Its IUPAC name is ethane;5-methyl-6-[(Z)-prop-1-enyl]cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | ethane;5-methyl-6-[(Z)-prop-1-enyl]cyclohexa-1,3-diene |
| PubChem CID | 143831212 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | ethane;5-methyl-6-[(Z)-prop-1-enyl]cyclohexa-1,3-diene |
| SMILES | C/C=C\C1C=CC=CC1C.CC |
| InChI | InChI=1S/C10H14.C2H6/c1-3-6-10-8-5-4-7-9(10)2;1-2/h3-10H,1-2H3;1-2H3/b6-3-; |
| InChIKey | ONYLJXDLJIFUEC-AQPBACSKSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-methyl-6-[(Z)-prop-1-enyl]cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methyl-6-[(Z)-prop-1-enyl]cyclohexa-1,3-diene?
The IUPAC name of ethane;5-methyl-6-[(Z)-prop-1-enyl]cyclohexa-1,3-diene (CID 143831212) is ethane;5-methyl-6-[(Z)-prop-1-enyl]cyclohexa-1,3-diene.
What is the SMILES notation for ethane;5-methyl-6-[(Z)-prop-1-enyl]cyclohexa-1,3-diene?
The canonical SMILES for ethane;5-methyl-6-[(Z)-prop-1-enyl]cyclohexa-1,3-diene is C/C=C\C1C=CC=CC1C.CC.
What is the InChIKey of ethane;5-methyl-6-[(Z)-prop-1-enyl]cyclohexa-1,3-diene?
The InChIKey is ONYLJXDLJIFUEC-AQPBACSKSA-N. The full InChI is InChI=1S/C10H14.C2H6/c1-3-6-10-8-5-4-7-9(10)2;1-2/h3-10H,1-2H3;1-2H3/b6-3-;.
What are the key properties of ethane;5-methyl-6-[(Z)-prop-1-enyl]cyclohexa-1,3-diene?
ethane;5-methyl-6-[(Z)-prop-1-enyl]cyclohexa-1,3-diene has a molecular weight of 164.29 g/mol, XLogP of 3.97, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methyl-6-[(Z)-prop-1-enyl]cyclohexa-1,3-diene is sourced from PubChem (CID 143831212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).