C27H42N2O2 — CID 143831337
(6'S)-3',6',12,13b-tetramethylspiro[1,2,4,6,7,7a,7b,8,9,11,13,13a-dodecahydroazuleno[2,1-a]quinolizine-10,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-one (PubChem CID 143831337) has the molecular formula C27H42N2O2 and a molecular weight of 426.65 g/mol. Its IUPAC name is (6'S)-3',6',12,13b-tetramethylspiro[1,2,4,6,7,7a,7b,8,9,11,13,13a-dodecahydroazuleno[2,1-a]quinolizine-10,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-one.
| Compound Name | (6'S)-3',6',12,13b-tetramethylspiro[1,2,4,6,7,7a,7b,8,9,11,13,13a-dodecahydroazuleno[2,1-a]quinolizine-10,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-one |
|---|---|
| PubChem CID | 143831337 |
| Molecular Formula | C27H42N2O2 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | (6'S)-3',6',12,13b-tetramethylspiro[1,2,4,6,7,7a,7b,8,9,11,13,13a-dodecahydroazuleno[2,1-a]quinolizine-10,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-one |
| SMILES | CC1=C2CC3C(CCN4CC(=O)CCC34C)C2CCC2(C1)OC1C[C@H](C)CNC1C2C |
| InChI | InChI=1S/C27H42N2O2/c1-16-11-24-25(28-14-16)18(3)27(31-24)9-6-20-21-7-10-29-15-19(30)5-8-26(29,4)23(21)12-22(20)17(2)13-27/h16,18,20-21,23-25,28H,5-15H2,1-4H3/t16-,18?,20?,21?,23?,24?,25?,26?,27?/m0/s1 |
| InChIKey | MZQIYCFEVNBKRM-LRUYTDHTSA-N |
| XLogP | 4.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|