C25H36N8O4S — CID 143831557
1-cyano-2-[6-[2-morpholin-4-ylethoxy(pyridin-3-ylmethyl)sulfamoyl]hexyl]-3-pyridin-4-ylguanidine (PubChem CID 143831557) has the molecular formula C25H36N8O4S and a molecular weight of 544.68 g/mol. Its IUPAC name is 1-cyano-2-[6-[2-morpholin-4-ylethoxy(pyridin-3-ylmethyl)sulfamoyl]hexyl]-3-pyridin-4-ylguanidine.
| Compound Name | 1-cyano-2-[6-[2-morpholin-4-ylethoxy(pyridin-3-ylmethyl)sulfamoyl]hexyl]-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 143831557 |
| Molecular Formula | C25H36N8O4S |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 1-cyano-2-[6-[2-morpholin-4-ylethoxy(pyridin-3-ylmethyl)sulfamoyl]hexyl]-3-pyridin-4-ylguanidine |
| SMILES | N#CN/C(=N\CCCCCCS(=O)(=O)N(Cc1cccnc1)OCCN1CCOCC1)Nc1ccncc1 |
| InChI | InChI=1S/C25H36N8O4S/c26-22-30-25(31-24-7-11-27-12-8-24)29-10-3-1-2-4-19-38(34,35)33(21-23-6-5-9-28-20-23)37-18-15-32-13-16-36-17-14-32/h5-9,11-12,20H,1-4,10,13-19,21H2,(H2,27,29,30,31) |
| InChIKey | BHLWFSOYIPWXPQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|