About ethane;(Z)-2-(ethylideneamino)-N,N-dimethylethenamine
ethane;(Z)-2-(ethylideneamino)-N,N-dimethylethenamine (PubChem CID 143832003) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is ethane;(Z)-2-(ethylideneamino)-N,N-dimethylethenamine.
Molecular Properties
| Compound Name | ethane;(Z)-2-(ethylideneamino)-N,N-dimethylethenamine |
| PubChem CID | 143832003 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | ethane;(Z)-2-(ethylideneamino)-N,N-dimethylethenamine |
| SMILES | C/C=N/C=C\N(C)C.CC |
| InChI | InChI=1S/C6H12N2.C2H6/c1-4-7-5-6-8(2)3;1-2/h4-6H,1-3H3;1-2H3/b6-5-,7-4+; |
| InChIKey | KSMOXKMCYCEVOI-BIFKCLKRSA-N |
| XLogP | 2.14 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z)-2-(ethylideneamino)-N,N-dimethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-2-(ethylideneamino)-N,N-dimethylethenamine?
The IUPAC name of ethane;(Z)-2-(ethylideneamino)-N,N-dimethylethenamine (CID 143832003) is ethane;(Z)-2-(ethylideneamino)-N,N-dimethylethenamine.
What is the SMILES notation for ethane;(Z)-2-(ethylideneamino)-N,N-dimethylethenamine?
The canonical SMILES for ethane;(Z)-2-(ethylideneamino)-N,N-dimethylethenamine is C/C=N/C=C\N(C)C.CC.
What is the InChIKey of ethane;(Z)-2-(ethylideneamino)-N,N-dimethylethenamine?
The InChIKey is KSMOXKMCYCEVOI-BIFKCLKRSA-N. The full InChI is InChI=1S/C6H12N2.C2H6/c1-4-7-5-6-8(2)3;1-2/h4-6H,1-3H3;1-2H3/b6-5-,7-4+;.
What are the key properties of ethane;(Z)-2-(ethylideneamino)-N,N-dimethylethenamine?
ethane;(Z)-2-(ethylideneamino)-N,N-dimethylethenamine has a molecular weight of 142.25 g/mol, XLogP of 2.14, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-2-(ethylideneamino)-N,N-dimethylethenamine is sourced from PubChem (CID 143832003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).