About butyl N-[2-(butylamino)-2-oxoethyl]-N-ethylcarbamate;molecular hydrogen
butyl N-[2-(butylamino)-2-oxoethyl]-N-ethylcarbamate;molecular hydrogen (PubChem CID 143832945) has the molecular formula C13H28N2O3
and a molecular weight of 260.38 g/mol. Its IUPAC name is butyl N-[2-(butylamino)-2-oxoethyl]-N-ethylcarbamate;molecular hydrogen.
Molecular Properties
| Compound Name | butyl N-[2-(butylamino)-2-oxoethyl]-N-ethylcarbamate;molecular hydrogen |
| PubChem CID | 143832945 |
| Molecular Formula | C13H28N2O3 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | butyl N-[2-(butylamino)-2-oxoethyl]-N-ethylcarbamate;molecular hydrogen |
| SMILES | CCCCNC(=O)CN(CC)C(=O)OCCCC.[H][H] |
| InChI | InChI=1S/C13H26N2O3.H2/c1-4-7-9-14-12(16)11-15(6-3)13(17)18-10-8-5-2;/h4-11H2,1-3H3,(H,14,16);1H |
| InChIKey | ZZNGVRMISVIWSB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl N-[2-(butylamino)-2-oxoethyl]-N-ethylcarbamate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl N-[2-(butylamino)-2-oxoethyl]-N-ethylcarbamate;molecular hydrogen?
The IUPAC name of butyl N-[2-(butylamino)-2-oxoethyl]-N-ethylcarbamate;molecular hydrogen (CID 143832945) is butyl N-[2-(butylamino)-2-oxoethyl]-N-ethylcarbamate;molecular hydrogen.
What is the SMILES notation for butyl N-[2-(butylamino)-2-oxoethyl]-N-ethylcarbamate;molecular hydrogen?
The canonical SMILES for butyl N-[2-(butylamino)-2-oxoethyl]-N-ethylcarbamate;molecular hydrogen is CCCCNC(=O)CN(CC)C(=O)OCCCC.[H][H].
What is the InChIKey of butyl N-[2-(butylamino)-2-oxoethyl]-N-ethylcarbamate;molecular hydrogen?
The InChIKey is ZZNGVRMISVIWSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O3.H2/c1-4-7-9-14-12(16)11-15(6-3)13(17)18-10-8-5-2;/h4-11H2,1-3H3,(H,14,16);1H.
What are the key properties of butyl N-[2-(butylamino)-2-oxoethyl]-N-ethylcarbamate;molecular hydrogen?
butyl N-[2-(butylamino)-2-oxoethyl]-N-ethylcarbamate;molecular hydrogen has a molecular weight of 260.38 g/mol, XLogP of 2.41, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl N-[2-(butylamino)-2-oxoethyl]-N-ethylcarbamate;molecular hydrogen is sourced from PubChem (CID 143832945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).