C23H20F2N4OS — CID 143833249
N-(2,6-difluorophenyl)formamide;13-(1H-imidazol-5-yl)-4-methyl-3-thia-5-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaene (PubChem CID 143833249) has the molecular formula C23H20F2N4OS and a molecular weight of 438.50 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)formamide;13-(1H-imidazol-5-yl)-4-methyl-3-thia-5-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaene.
| Compound Name | N-(2,6-difluorophenyl)formamide;13-(1H-imidazol-5-yl)-4-methyl-3-thia-5-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaene |
|---|---|
| PubChem CID | 143833249 |
| Molecular Formula | C23H20F2N4OS |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N-(2,6-difluorophenyl)formamide;13-(1H-imidazol-5-yl)-4-methyl-3-thia-5-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaene |
| SMILES | Cc1nc2c(s1)-c1cc(-c3cnc[nH]3)ccc1CCC2.O=CNc1c(F)cccc1F |
| InChI | InChI=1S/C16H15N3S.C7H5F2NO/c1-10-19-14-4-2-3-11-5-6-12(15-8-17-9-18-15)7-13(11)16(14)20-10;8-5-2-1-3-6(9)7(5)10-4-11/h5-9H,2-4H2,1H3,(H,17,18);1-4H,(H,10,11) |
| InChIKey | DXKJGZRAVGWCLL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|