C10H10F3N3O — CID 143833676
4-[(1Z,3Z)-1,4-diamino-5,5,5-trifluoropenta-1,3-dienyl]-1H-pyridin-2-one (PubChem CID 143833676) has the molecular formula C10H10F3N3O and a molecular weight of 245.20 g/mol. Its IUPAC name is 4-[(1Z,3Z)-1,4-diamino-5,5,5-trifluoropenta-1,3-dienyl]-1H-pyridin-2-one.
| Compound Name | 4-[(1Z,3Z)-1,4-diamino-5,5,5-trifluoropenta-1,3-dienyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 143833676 |
| Molecular Formula | C10H10F3N3O |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 4-[(1Z,3Z)-1,4-diamino-5,5,5-trifluoropenta-1,3-dienyl]-1H-pyridin-2-one |
| SMILES | N/C(=C\C=C(/N)C(F)(F)F)c1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C10H10F3N3O/c11-10(12,13)8(15)2-1-7(14)6-3-4-16-9(17)5-6/h1-5H,14-15H2,(H,16,17)/b7-1-,8-2- |
| InChIKey | USHLCJYDEXHIBO-NDBDHSCESA-N |
| XLogP | 1.08 |
| TPSA | 84.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|