C24H43N — CID 143834115
(4E,6E)-4,7-dimethyl-1-phenyl-N-propylnona-4,6-dien-3-amine;ethane (PubChem CID 143834115) has the molecular formula C24H43N and a molecular weight of 345.62 g/mol. Its IUPAC name is (4E,6E)-4,7-dimethyl-1-phenyl-N-propylnona-4,6-dien-3-amine;ethane.
| Compound Name | (4E,6E)-4,7-dimethyl-1-phenyl-N-propylnona-4,6-dien-3-amine;ethane |
|---|---|
| PubChem CID | 143834115 |
| Molecular Formula | C24H43N |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 345.34 |
| IUPAC Name | (4E,6E)-4,7-dimethyl-1-phenyl-N-propylnona-4,6-dien-3-amine;ethane |
| SMILES | CC.CC.CCCNC(CCc1ccccc1)/C(C)=C/C=C(\C)CC |
| InChI | InChI=1S/C20H31N.2C2H6/c1-5-16-21-20(18(4)13-12-17(3)6-2)15-14-19-10-8-7-9-11-19;2*1-2/h7-13,20-21H,5-6,14-16H2,1-4H3;2*1-2H3/b17-12+,18-13+;; |
| InChIKey | AZZUUMSPRWXWOQ-IBGYSACPSA-N |
| XLogP | 7.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|