C14H16FNO2S — CID 143834636
[(4aS,7aS)-7a-(2-fluorophenyl)-2-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-5-yl]methanol (PubChem CID 143834636) has the molecular formula C14H16FNO2S and a molecular weight of 281.35 g/mol. Its IUPAC name is [(4aS,7aS)-7a-(2-fluorophenyl)-2-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-5-yl]methanol.
| Compound Name | [(4aS,7aS)-7a-(2-fluorophenyl)-2-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-5-yl]methanol |
|---|---|
| PubChem CID | 143834636 |
| Molecular Formula | C14H16FNO2S |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | [(4aS,7aS)-7a-(2-fluorophenyl)-2-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-5-yl]methanol |
| SMILES | CC1=N[C@@]2(c3ccccc3F)COC(CO)[C@H]2CS1 |
| InChI | InChI=1S/C14H16FNO2S/c1-9-16-14(10-4-2-3-5-12(10)15)8-18-13(6-17)11(14)7-19-9/h2-5,11,13,17H,6-8H2,1H3/t11-,13?,14-/m1/s1 |
| InChIKey | DHHNHURNXKULAC-AODWJNRKSA-N |
| XLogP | 2.19 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |