About methanamine;(E)-2-[(Z)-prop-1-enyl]pent-2-enal
methanamine;(E)-2-[(Z)-prop-1-enyl]pent-2-enal (PubChem CID 143834779) has the molecular formula C9H17NO
and a molecular weight of 155.24 g/mol. Its IUPAC name is methanamine;(E)-2-[(Z)-prop-1-enyl]pent-2-enal.
Molecular Properties
| Compound Name | methanamine;(E)-2-[(Z)-prop-1-enyl]pent-2-enal |
| PubChem CID | 143834779 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | methanamine;(E)-2-[(Z)-prop-1-enyl]pent-2-enal |
| SMILES | C/C=C\C(C=O)=C/CC.CN |
| InChI | InChI=1S/C8H12O.CH5N/c1-3-5-8(7-9)6-4-2;1-2/h3,5-7H,4H2,1-2H3;2H2,1H3/b5-3-,8-6+; |
| InChIKey | FSCGIQPJWPZEBG-MQASBHRKSA-N |
| XLogP | 1.67 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methanamine;(E)-2-[(Z)-prop-1-enyl]pent-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;(E)-2-[(Z)-prop-1-enyl]pent-2-enal?
The IUPAC name of methanamine;(E)-2-[(Z)-prop-1-enyl]pent-2-enal (CID 143834779) is methanamine;(E)-2-[(Z)-prop-1-enyl]pent-2-enal.
What is the SMILES notation for methanamine;(E)-2-[(Z)-prop-1-enyl]pent-2-enal?
The canonical SMILES for methanamine;(E)-2-[(Z)-prop-1-enyl]pent-2-enal is C/C=C\C(C=O)=C/CC.CN.
What is the InChIKey of methanamine;(E)-2-[(Z)-prop-1-enyl]pent-2-enal?
The InChIKey is FSCGIQPJWPZEBG-MQASBHRKSA-N. The full InChI is InChI=1S/C8H12O.CH5N/c1-3-5-8(7-9)6-4-2;1-2/h3,5-7H,4H2,1-2H3;2H2,1H3/b5-3-,8-6+;.
What are the key properties of methanamine;(E)-2-[(Z)-prop-1-enyl]pent-2-enal?
methanamine;(E)-2-[(Z)-prop-1-enyl]pent-2-enal has a molecular weight of 155.24 g/mol, XLogP of 1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;(E)-2-[(Z)-prop-1-enyl]pent-2-enal is sourced from PubChem (CID 143834779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).