About (6Z,8E)-N-(2-methylpropyl)-3-methylsulfanyldeca-6,8-dienamide
(6Z,8E)-N-(2-methylpropyl)-3-methylsulfanyldeca-6,8-dienamide (PubChem CID 143834867) has the molecular formula C15H27NOS
and a molecular weight of 269.45 g/mol. Its IUPAC name is (6Z,8E)-N-(2-methylpropyl)-3-methylsulfanyldeca-6,8-dienamide.
Molecular Properties
| Compound Name | (6Z,8E)-N-(2-methylpropyl)-3-methylsulfanyldeca-6,8-dienamide |
| PubChem CID | 143834867 |
| Molecular Formula | C15H27NOS |
| Molecular Weight | 269.45 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | (6Z,8E)-N-(2-methylpropyl)-3-methylsulfanyldeca-6,8-dienamide |
| SMILES | C/C=C/C=C\CCC(CC(=O)NCC(C)C)SC |
| InChI | InChI=1S/C15H27NOS/c1-5-6-7-8-9-10-14(18-4)11-15(17)16-12-13(2)3/h5-8,13-14H,9-12H2,1-4H3,(H,16,17)/b6-5+,8-7- |
| InChIKey | VVPUNRIFATYVDP-MDAAKZFYSA-N |
| XLogP | 3.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (6Z,8E)-N-(2-methylpropyl)-3-methylsulfanyldeca-6,8-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z,8E)-N-(2-methylpropyl)-3-methylsulfanyldeca-6,8-dienamide?
The IUPAC name of (6Z,8E)-N-(2-methylpropyl)-3-methylsulfanyldeca-6,8-dienamide (CID 143834867) is (6Z,8E)-N-(2-methylpropyl)-3-methylsulfanyldeca-6,8-dienamide.
What is the SMILES notation for (6Z,8E)-N-(2-methylpropyl)-3-methylsulfanyldeca-6,8-dienamide?
The canonical SMILES for (6Z,8E)-N-(2-methylpropyl)-3-methylsulfanyldeca-6,8-dienamide is C/C=C/C=C\CCC(CC(=O)NCC(C)C)SC.
What is the InChIKey of (6Z,8E)-N-(2-methylpropyl)-3-methylsulfanyldeca-6,8-dienamide?
The InChIKey is VVPUNRIFATYVDP-MDAAKZFYSA-N. The full InChI is InChI=1S/C15H27NOS/c1-5-6-7-8-9-10-14(18-4)11-15(17)16-12-13(2)3/h5-8,13-14H,9-12H2,1-4H3,(H,16,17)/b6-5+,8-7-.
What are the key properties of (6Z,8E)-N-(2-methylpropyl)-3-methylsulfanyldeca-6,8-dienamide?
(6Z,8E)-N-(2-methylpropyl)-3-methylsulfanyldeca-6,8-dienamide has a molecular weight of 269.45 g/mol, XLogP of 3.79, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z,8E)-N-(2-methylpropyl)-3-methylsulfanyldeca-6,8-dienamide is sourced from PubChem (CID 143834867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).