C14H23NO2 — CID 143834976
(3Z,4E)-3-ethylidene-1-piperidin-1-ylhepta-4,6-diene-2,4-diol (PubChem CID 143834976) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is (3Z,4E)-3-ethylidene-1-piperidin-1-ylhepta-4,6-diene-2,4-diol.
| Compound Name | (3Z,4E)-3-ethylidene-1-piperidin-1-ylhepta-4,6-diene-2,4-diol |
|---|---|
| PubChem CID | 143834976 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | (3Z,4E)-3-ethylidene-1-piperidin-1-ylhepta-4,6-diene-2,4-diol |
| SMILES | C=C/C=C(O)\C(=C/C)C(O)CN1CCCCC1 |
| InChI | InChI=1S/C14H23NO2/c1-3-8-13(16)12(4-2)14(17)11-15-9-6-5-7-10-15/h3-4,8,14,16-17H,1,5-7,9-11H2,2H3/b12-4+,13-8+ |
| InChIKey | FLMZDGQVSFIGKS-KMIQJRPCSA-N |
| XLogP | 2.41 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|