C23H15F5N4O — CID 143835123
1-[2,2-difluoro-2-(3-methoxyquinolin-6-yl)ethanimidoyl]-5-(3,5-difluorophenyl)-3-fluoropyridin-2-imine (PubChem CID 143835123) has the molecular formula C23H15F5N4O and a molecular weight of 458.39 g/mol. Its IUPAC name is 1-[2,2-difluoro-2-(3-methoxyquinolin-6-yl)ethanimidoyl]-5-(3,5-difluorophenyl)-3-fluoropyridin-2-imine.
| Compound Name | 1-[2,2-difluoro-2-(3-methoxyquinolin-6-yl)ethanimidoyl]-5-(3,5-difluorophenyl)-3-fluoropyridin-2-imine |
|---|---|
| PubChem CID | 143835123 |
| Molecular Formula | C23H15F5N4O |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 1-[2,2-difluoro-2-(3-methoxyquinolin-6-yl)ethanimidoyl]-5-(3,5-difluorophenyl)-3-fluoropyridin-2-imine |
| SMILES | [H]/N=C(/n1cc(-c2cc(F)cc(F)c2)cc(F)/c1=N\[H])C(F)(F)c1ccc2ncc(OC)cc2c1 |
| InChI | InChI=1S/C23H15F5N4O/c1-33-18-7-13-4-15(2-3-20(13)31-10-18)23(27,28)22(30)32-11-14(8-19(26)21(32)29)12-5-16(24)9-17(25)6-12/h2-11,29-30H,1H3/b29-21+,30-22+ |
| InChIKey | KLIKOYJYFPRJFC-VFIVCBTMSA-N |
| XLogP | 5.23 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|