C18H23Cl2N3 — CID 143835693
N-[1-(2,3-dichlorophenyl)-2-pyridin-4-ylethyl]-N'-methylethanimidamide;ethane (PubChem CID 143835693) has the molecular formula C18H23Cl2N3 and a molecular weight of 352.31 g/mol. Its IUPAC name is N-[1-(2,3-dichlorophenyl)-2-pyridin-4-ylethyl]-N'-methylethanimidamide;ethane.
| Compound Name | N-[1-(2,3-dichlorophenyl)-2-pyridin-4-ylethyl]-N'-methylethanimidamide;ethane |
|---|---|
| PubChem CID | 143835693 |
| Molecular Formula | C18H23Cl2N3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-[1-(2,3-dichlorophenyl)-2-pyridin-4-ylethyl]-N'-methylethanimidamide;ethane |
| SMILES | C/N=C(\C)NC(Cc1ccncc1)c1cccc(Cl)c1Cl.CC |
| InChI | InChI=1S/C16H17Cl2N3.C2H6/c1-11(19-2)21-15(10-12-6-8-20-9-7-12)13-4-3-5-14(17)16(13)18;1-2/h3-9,15H,10H2,1-2H3,(H,19,21);1-2H3 |
| InChIKey | QYPPUXNGXKHZBL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|