C28H34N4O4S — CID 143836171
acetaldehyde;(2Z)-2-[[2-hydroxy-3-[(E)-1-methylsulfanylbut-1-en-3-yn-2-yl]phenyl]hydrazinylidene]-3-imino-N-(5,6,7,8-tetrahydronaphthalen-2-yl)butanamide;methanol (PubChem CID 143836171) has the molecular formula C28H34N4O4S and a molecular weight of 522.67 g/mol. Its IUPAC name is acetaldehyde;(2Z)-2-[[2-hydroxy-3-[(E)-1-methylsulfanylbut-1-en-3-yn-2-yl]phenyl]hydrazinylidene]-3-imino-N-(5,6,7,8-tetrahydronaphthalen-2-yl)butanamide;methanol.
| Compound Name | acetaldehyde;(2Z)-2-[[2-hydroxy-3-[(E)-1-methylsulfanylbut-1-en-3-yn-2-yl]phenyl]hydrazinylidene]-3-imino-N-(5,6,7,8-tetrahydronaphthalen-2-yl)butanamide;methanol |
|---|---|
| PubChem CID | 143836171 |
| Molecular Formula | C28H34N4O4S |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | acetaldehyde;(2Z)-2-[[2-hydroxy-3-[(E)-1-methylsulfanylbut-1-en-3-yn-2-yl]phenyl]hydrazinylidene]-3-imino-N-(5,6,7,8-tetrahydronaphthalen-2-yl)butanamide;methanol |
| SMILES | CC=O.CO.[H]/N=C(C)/C(=N/Nc1cccc(/C(C#C)=C/SC)c1O)C(=O)Nc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C25H26N4O2S.C2H4O.CH4O/c1-4-17(15-32-3)21-10-7-11-22(24(21)30)28-29-23(16(2)26)25(31)27-20-13-12-18-8-5-6-9-19(18)14-20;1-2-3;1-2/h1,7,10-15,26,28,30H,5-6,8-9H2,2-3H3,(H,27,31);2H,1H3;2H,1H3/b17-15+,26-16+,29-23-;; |
| InChIKey | FDGSIKUDATZETQ-ZUSZDBOWSA-N |
| XLogP | 4.87 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|