C23H20N4O5 — CID 143836246
5-[3-[(2Z)-2-[1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylamino)-3-imino-1-oxobutan-2-ylidene]hydrazinyl]-2-hydroxyphenyl]furan-2-carboxylic acid (PubChem CID 143836246) has the molecular formula C23H20N4O5 and a molecular weight of 432.44 g/mol. Its IUPAC name is 5-[3-[(2Z)-2-[1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylamino)-3-imino-1-oxobutan-2-ylidene]hydrazinyl]-2-hydroxyphenyl]furan-2-carboxylic acid.
| Compound Name | 5-[3-[(2Z)-2-[1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylamino)-3-imino-1-oxobutan-2-ylidene]hydrazinyl]-2-hydroxyphenyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 143836246 |
| Molecular Formula | C23H20N4O5 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 5-[3-[(2Z)-2-[1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylamino)-3-imino-1-oxobutan-2-ylidene]hydrazinyl]-2-hydroxyphenyl]furan-2-carboxylic acid |
| SMILES | [H]/N=C(C)/C(=N/Nc1cccc(-c2ccc(C(=O)O)o2)c1O)C(=O)Nc1ccc2c(c1)CC2 |
| InChI | InChI=1S/C23H20N4O5/c1-12(24)20(22(29)25-15-8-7-13-5-6-14(13)11-15)27-26-17-4-2-3-16(21(17)28)18-9-10-19(32-18)23(30)31/h2-4,7-11,24,26,28H,5-6H2,1H3,(H,25,29)(H,30,31)/b24-12+,27-20- |
| InChIKey | HGIKNEOFMFOIIE-KQRJGSHHSA-N |
| XLogP | 3.90 |
| TPSA | 148.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|