C14H17IO4S — CID 14383673
(6R,9R)-6-benzyl-9-iodo-1,4-dioxa-8lambda6-thiaspiro[4.5]decane 8,8-dioxide (PubChem CID 14383673) has the molecular formula C14H17IO4S and a molecular weight of 408.26 g/mol. Its IUPAC name is (6R,9R)-6-benzyl-9-iodo-1,4-dioxa-8lambda6-thiaspiro[4.5]decane 8,8-dioxide.
| Compound Name | (6R,9R)-6-benzyl-9-iodo-1,4-dioxa-8lambda6-thiaspiro[4.5]decane 8,8-dioxide |
|---|---|
| PubChem CID | 14383673 |
| Molecular Formula | C14H17IO4S |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | (6R,9R)-6-benzyl-9-iodo-1,4-dioxa-8lambda6-thiaspiro[4.5]decane 8,8-dioxide |
| SMILES | O=S1(=O)C[C@H](Cc2ccccc2)C2(C[C@H]1I)OCCO2 |
| InChI | InChI=1S/C14H17IO4S/c15-13-9-14(18-6-7-19-14)12(10-20(13,16)17)8-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2/t12-,13-/m0/s1 |
| InChIKey | DOLZAJFRFXREJS-STQMWFEESA-N |
| XLogP | 2.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|