C9H16NO2+ — CID 143837540
[(4Z,6Z)-3,7-dihydroxy-3-methylhepta-1,4,6-trien-2-yl]-methylazanium (PubChem CID 143837540) has the molecular formula C9H16NO2+ and a molecular weight of 170.23 g/mol. Its IUPAC name is [(4Z,6Z)-3,7-dihydroxy-3-methylhepta-1,4,6-trien-2-yl]-methylazanium.
| Compound Name | [(4Z,6Z)-3,7-dihydroxy-3-methylhepta-1,4,6-trien-2-yl]-methylazanium |
|---|---|
| PubChem CID | 143837540 |
| Molecular Formula | C9H16NO2+ |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | [(4Z,6Z)-3,7-dihydroxy-3-methylhepta-1,4,6-trien-2-yl]-methylazanium |
| SMILES | C=C([NH2+]C)C(C)(O)/C=C\C=C/O |
| InChI | InChI=1S/C9H15NO2/c1-8(10-3)9(2,12)6-4-5-7-11/h4-7,10-12H,1H2,2-3H3/p+1/b6-4-,7-5- |
| InChIKey | WOROMYNWIKDFGT-PEPZGXQESA-O |
| XLogP | 0.07 |
| TPSA | 57.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|